CAS 142975-48-2 appears in our catalog under these names: Cefalexin Impurity 8, 3-(Hydroxymethylene)-6-phenyl-2,5-piperazinedione, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-(hydroxymethylidene)-6-phenylpiperazine-2,5-dione (CAS 142975-48-2) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 3-(hydroxymethylidene)-6-phenylpiperazine-2,5-dione. InChIKey: WSNUQNLXONWSFX-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-(hydroxymethylidene)-6-phenylpiperazine-2,5-dione |
| InChIKey | WSNUQNLXONWSFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=O)NC(=CO)C(=O)N2 |
Computed by PubChem (NCBI)