CAS 1429903-69-4 is the registry number for 4-Methoxy-3,5-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
4-methoxy-3,5-dimethylbenzamide (CAS 1429903-69-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-methoxy-3,5-dimethylbenzamide. InChIKey: LCXMWXFRPFWQBZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-methoxy-3,5-dimethylbenzamide |
| InChIKey | LCXMWXFRPFWQBZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C)C(=O)N |
Computed by PubChem (NCBI)