Products 1429903-69-4

CAS 1429903-69-4 is the registry number for 4-Methoxy-3,5-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-methoxy-3,5-dimethylbenzamide (CAS 1429903-69-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-methoxy-3,5-dimethylbenzamide. InChIKey: LCXMWXFRPFWQBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC name4-methoxy-3,5-dimethylbenzamide
InChIKeyLCXMWXFRPFWQBZ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1OC)C)C(=O)N

Computed by PubChem (NCBI)