Products 88127-22-4
CAS 88127-22-4 appears in our catalog under these names: 2’-Deoxy-N2-dimethylguanosine, 2’-Deoxy-N2,N2-dimethylguanosine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 500mg, 10 mg, 5 mg, 1 mg.
2-(dimethylamino)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 88127-22-4) is a chemical compound with the molecular formula C12H17N5O4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-(dimethylamino)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: IKDIHBAQIZQROC-XLPZGREQSA-N.
| Molecular formula | C12H17N5O4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-(dimethylamino)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | IKDIHBAQIZQROC-XLPZGREQSA-N |
| SMILES | CN(C)C1=NC2=C(C(=O)N1)N=CN2[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)