Products 1430105-51-3
CAS 1430105-51-3 is the registry number for 5-(1,1-Dimethylethyl) 6-methyl (3R,6S)-1,1-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-O-tert-butyl 6-O-methyl (3R,6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylate (CAS 1430105-51-3) is a chemical compound with the molecular formula C13H19F2NO4 and a molecular weight of 291.29 g/mol. IUPAC name: 5-O-tert-butyl 6-O-methyl (3R,6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylate. InChIKey: TZYVXHLYXQBEPH-QPUJVOFHSA-N.
| Molecular formula | C13H19F2NO4 |
|---|---|
| Molecular weight | 291.29 g/mol |
| IUPAC name | 5-O-tert-butyl 6-O-methyl (3R,6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylate |
| InChIKey | TZYVXHLYXQBEPH-QPUJVOFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@]2(C[C@H]1C(=O)OC)CC2(F)F |
Computed by PubChem (NCBI)