CAS 2386127-29-1 is the registry number for 6-(tert-Butoxycarbonyl)-2,2-difluoro-6-azaspiro(3.4)octane-7-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2,2-difluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid (CAS 2386127-29-1) is a chemical compound with the molecular formula C13H19F2NO4 and a molecular weight of 291.29 g/mol. IUPAC name: 2,2-difluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid. InChIKey: HPLUHOJHYYJMSU-UHFFFAOYSA-N.
| Molecular formula | C13H19F2NO4 |
|---|---|
| Molecular weight | 291.29 g/mol |
| IUPAC name | 2,2-difluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid |
| InChIKey | HPLUHOJHYYJMSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC1C(=O)O)CC(C2)(F)F |
Computed by PubChem (NCBI)