CAS 1823847-01-3 appears in our catalog under these names: 1-tert-Butyl 3-ethyl 5,5-difluoro-5,6-dihydropyridine-1,3(2h)-dicarboxylate, 95%, 1-(tert-Butyl) 3-ethyl 5,5-difluoro-5,6-dihydropyridine-1,3(2H)-dicarboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-O-tert-butyl 3-O-ethyl 5,5-difluoro-2,6-dihydropyridine-1,3-dicarboxylate (CAS 1823847-01-3) is a chemical compound with the molecular formula C13H19F2NO4 and a molecular weight of 291.29 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 5,5-difluoro-2,6-dihydropyridine-1,3-dicarboxylate. InChIKey: DBOWFSVUQDKCNZ-UHFFFAOYSA-N.
| Molecular formula | C13H19F2NO4 |
|---|---|
| Molecular weight | 291.29 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 5,5-difluoro-2,6-dihydropyridine-1,3-dicarboxylate |
| InChIKey | DBOWFSVUQDKCNZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(CN(C1)C(=O)OC(C)(C)C)(F)F |
Computed by PubChem (NCBI)