Products 2384170-69-6
CAS 2384170-69-6 is the registry number for 6-(1,1-Dimethylethyl) 2,2-difluoro-6-azaspiro[2.5]octane-1,6-dicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-difluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-1-carboxylic acid (CAS 2384170-69-6) is a chemical compound with the molecular formula C13H19F2NO4 and a molecular weight of 291.29 g/mol. IUPAC name: 2,2-difluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-1-carboxylic acid. InChIKey: VQWLZBIABHGLHV-UHFFFAOYSA-N.
| Molecular formula | C13H19F2NO4 |
|---|---|
| Molecular weight | 291.29 g/mol |
| IUPAC name | 2,2-difluoro-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-1-carboxylic acid |
| InChIKey | VQWLZBIABHGLHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(C2(F)F)C(=O)O |
Computed by PubChem (NCBI)