Products 1430334-05-6
CAS 1430334-05-6 is the registry number for Disporopsin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-3-[(2,4-dihydroxyphenyl)methyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one (CAS 1430334-05-6) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: (3R)-3-[(2,4-dihydroxyphenyl)methyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one. InChIKey: GAAPRCAFLGLOJU-SECBINFHSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | (3R)-3-[(2,4-dihydroxyphenyl)methyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| InChIKey | GAAPRCAFLGLOJU-SECBINFHSA-N |
| SMILES | C1[C@H](C(=O)C2=C(C=C(C=C2O1)O)O)CC3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)