CAS 1430798-23-4 is the registry number for IP-DNQ. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,6-dimethyl-1-(3-methylbutyl)-9H-pyrido[3,2-g]quinoline-2,5,8,10-tetrone (CAS 1430798-23-4) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: 4,6-dimethyl-1-(3-methylbutyl)-9H-pyrido[3,2-g]quinoline-2,5,8,10-tetrone. InChIKey: KSDAYRXQDULQPE-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4,6-dimethyl-1-(3-methylbutyl)-9H-pyrido[3,2-g]quinoline-2,5,8,10-tetrone |
| InChIKey | KSDAYRXQDULQPE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C(=O)C3=C(C2=O)N(C(=O)C=C3C)CCC(C)C |
Computed by PubChem (NCBI)