CAS 14309-63-8 appears in our catalog under these names: Isoprenaline Impurity 1 , Isoproterenol Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
4-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,2-dione (CAS 14309-63-8) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,2-dione. InChIKey: IQJDWGBGLVHLOY-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]cyclohexa-3,5-diene-1,2-dione |
| InChIKey | IQJDWGBGLVHLOY-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC(=O)C(=O)C=C1)O |
Computed by PubChem (NCBI)