Products 1431303-55-7
CAS 1431303-55-7 appears in our catalog under these names: 5,6-Epoxy-9-cis-Retinoic Acid, 9-cis-5,6-Epoxy-5,6-dihydro-retinoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 5mg.
(2E,4E,6Z,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenoic acid (CAS 1431303-55-7) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenoic acid. InChIKey: KEEHJLBAOLGBJZ-OZBVMKDFSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenoic acid |
| InChIKey | KEEHJLBAOLGBJZ-OZBVMKDFSA-N |
| SMILES | C/C(=C/C=C/C(=C/C(=O)O)/C)/C=C/C12C(CCCC1(O2)C)(C)C |
Computed by PubChem (NCBI)