CAS 81444-57-7 appears in our catalog under these names: Isotretinoin EP Impurity G(13-cis-5,6-dihydro-5,6-epoxyretinoic acid), Isotretinoin EP Impurity G (5,6-Epoxy-13-cis Retinoic Acid), 5,6-Epoxy-13-cis Retinoic Acid, 5,6–epoxy–13–cis Retinoic Acid. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 500μg, 2mg, 10 mg, 5 mg.
(2Z,4E,6E,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenoic acid (CAS 81444-57-7) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenoic acid. InChIKey: KEEHJLBAOLGBJZ-NJZIYGCESA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenoic acid |
| InChIKey | KEEHJLBAOLGBJZ-NJZIYGCESA-N |
| SMILES | C/C(=C\C=C\C(=C/C(=O)O)\C)/C=C/C12C(CCCC1(O2)C)(C)C |
Computed by PubChem (NCBI)