Products 3012-76-8
CAS 3012-76-8 appears in our catalog under these names: 5,8-Epoxy-all-trans-Retinoic Acid (Mixture of Diastereomers), 5,8-Epoxytretinoin, all-trans 5,8-Epoxy Retinoic Acid (Mixture of Diastereomers). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg.
(2E,4E,6E)-7-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-3-methylocta-2,4,6-trienoic acid (CAS 3012-76-8) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: (2E,4E,6E)-7-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-3-methylocta-2,4,6-trienoic acid. InChIKey: QDOSIDVGVRAXSE-JUPVTLSTSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2E,4E,6E)-7-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-3-methylocta-2,4,6-trienoic acid |
| InChIKey | QDOSIDVGVRAXSE-JUPVTLSTSA-N |
| SMILES | C/C(=C\C(=O)O)/C=C/C=C(\C)/C1C=C2C(CCCC2(O1)C)(C)C |
Computed by PubChem (NCBI)