CAS 469-26-1 appears in our catalog under these names: Petasin Impurity 1 (Isopetasin), Isopetasin. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
[(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (Z)-2-methylbut-2-enoate (CAS 469-26-1) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: [(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (Z)-2-methylbut-2-enoate. InChIKey: OFDHBFFGRFCQOW-KSEJUSODSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | [(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | OFDHBFFGRFCQOW-KSEJUSODSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@@H]1CCC2=CC(=O)C(=C(C)C)C[C@@]2([C@H]1C)C |
Computed by PubChem (NCBI)