Products 1431330-19-6
CAS 1431330-19-6 is the registry number for 3-Bromo-2-(methoxymethoxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[3-bromo-2-(methoxymethoxy)phenyl]boronic acid (CAS 1431330-19-6) is a chemical compound with the molecular formula C8H10BBrO4 and a molecular weight of 260.88 g/mol. IUPAC name: [3-bromo-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: PGUWZDWJOLEJNF-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO4 |
|---|---|
| Molecular weight | 260.88 g/mol |
| IUPAC name | [3-bromo-2-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | PGUWZDWJOLEJNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)OCOC)(O)O |
Computed by PubChem (NCBI)