CAS 2414154-40-6 is the registry number for 5-Bromo-2,4-dimethoxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(5-bromo-2,4-dimethoxyphenyl)boronic acid (CAS 2414154-40-6) is a chemical compound with the molecular formula C8H10BBrO4 and a molecular weight of 260.88 g/mol. IUPAC name: (5-bromo-2,4-dimethoxyphenyl)boronic acid. InChIKey: DSAWAOHHKILZPQ-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO4 |
|---|---|
| Molecular weight | 260.88 g/mol |
| IUPAC name | (5-bromo-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | DSAWAOHHKILZPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)OC)Br)(O)O |
Computed by PubChem (NCBI)