Products 2414154-40-6

CAS 2414154-40-6 is the registry number for 5-Bromo-2,4-dimethoxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(5-bromo-2,4-dimethoxyphenyl)boronic acid (CAS 2414154-40-6) is a chemical compound with the molecular formula C8H10BBrO4 and a molecular weight of 260.88 g/mol. IUPAC name: (5-bromo-2,4-dimethoxyphenyl)boronic acid. InChIKey: DSAWAOHHKILZPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BBrO4
Molecular weight260.88 g/mol
IUPAC name(5-bromo-2,4-dimethoxyphenyl)boronic acid
InChIKeyDSAWAOHHKILZPQ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1OC)OC)Br)(O)O

Computed by PubChem (NCBI)