Products 1595078-24-2
CAS 1595078-24-2 is the registry number for (2-bromo-4,5-dimethoxyphenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2-bromo-4,5-dimethoxyphenyl)boronic acid (CAS 1595078-24-2) is a chemical compound with the molecular formula C8H10BBrO4 and a molecular weight of 260.88 g/mol. IUPAC name: (2-bromo-4,5-dimethoxyphenyl)boronic acid. InChIKey: XJLHETHRDARYAQ-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO4 |
|---|---|
| Molecular weight | 260.88 g/mol |
| IUPAC name | (2-bromo-4,5-dimethoxyphenyl)boronic acid |
| InChIKey | XJLHETHRDARYAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Br)OC)OC)(O)O |
Computed by PubChem (NCBI)