CAS 2121515-00-0 appears in our catalog under these names: 3-Bromo-2,6-dimethoxyphenylboronic acid, 97%, (3-Bromo-2,6-dimethoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
(3-bromo-2,6-dimethoxyphenyl)boronic acid (CAS 2121515-00-0) is a chemical compound with the molecular formula C8H10BBrO4 and a molecular weight of 260.88 g/mol. IUPAC name: (3-bromo-2,6-dimethoxyphenyl)boronic acid. InChIKey: WAKKMVAQHOAAMB-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO4 |
|---|---|
| Molecular weight | 260.88 g/mol |
| IUPAC name | (3-bromo-2,6-dimethoxyphenyl)boronic acid |
| InChIKey | WAKKMVAQHOAAMB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)Br)OC)(O)O |
Computed by PubChem (NCBI)