CAS 1431546-21-2 appears in our catalog under these names: 2-[2-Fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid, 95%, 2-(2-FLuoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g.
2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (CAS 1431546-21-2) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid. InChIKey: MAXJGDSSNSSIKE-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| InChIKey | MAXJGDSSNSSIKE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CC(=O)O |
Computed by PubChem (NCBI)