CAS 1431554-41-4 is the registry number for Ethyl 2-chloroimidazo[1,2-a]pyrimidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-chloroimidazo[1,2-a]pyrimidine-3-carboxylate (CAS 1431554-41-4) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 2-chloroimidazo[1,2-a]pyrimidine-3-carboxylate. InChIKey: IWXPNLTWQCJQKF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 2-chloroimidazo[1,2-a]pyrimidine-3-carboxylate |
| InChIKey | IWXPNLTWQCJQKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2N1C=CC=N2)Cl |
Computed by PubChem (NCBI)