CAS 143158-15-0 appears in our catalog under these names: (2,4-Bis(trifluoromethyl)phenyl)methanol 95%, (2,4-Bis(trifluoromethyl)phenyl)methanol, 96%, 96%, 2,4-Bis(trifluoromethyl)benzyl alcohol, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
[2,4-bis(trifluoromethyl)phenyl]methanol (CAS 143158-15-0) is a chemical compound with the molecular formula C9H6F6O and a molecular weight of 244.13 g/mol. IUPAC name: [2,4-bis(trifluoromethyl)phenyl]methanol. InChIKey: NDHDRXKQSOFDNV-UHFFFAOYSA-N.
| Molecular formula | C9H6F6O |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | [2,4-bis(trifluoromethyl)phenyl]methanol |
| InChIKey | NDHDRXKQSOFDNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CO |
Computed by PubChem (NCBI)