CAS 32707-89-4 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)benzyl alcohol, 3,5–Bis(trifluoromethyl)benzyl alcohol, 3,5-Bis(trifluoromethyl)benzyl alcohol, 98% , 3,5-Bis(trifluoromethyl)benzyl Alcohol, >98.0%(GC), (3,5-Bis(trifluoromethyl)phenyl)methanol 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100mg, 100g, 25g, 1g, 5g, 1000g, 500g, 10g.
[3,5-bis(trifluoromethyl)phenyl]methanol (CAS 32707-89-4) is a chemical compound with the molecular formula C9H6F6O and a molecular weight of 244.13 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]methanol. InChIKey: BJTWPJOGDWRYDD-UHFFFAOYSA-N.
| Molecular formula | C9H6F6O |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]methanol |
| InChIKey | BJTWPJOGDWRYDD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CO |
Computed by PubChem (NCBI)