Products 442863-76-5
CAS 442863-76-5 is the registry number for (R)-2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanol (CAS 442863-76-5) is a chemical compound with the molecular formula C9H6F6O and a molecular weight of 244.13 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanol. InChIKey: HGNBZXDFLLAPLI-SSDOTTSWSA-N.
| Molecular formula | C9H6F6O |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanol |
| InChIKey | HGNBZXDFLLAPLI-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)