CAS 302911-97-3 appears in our catalog under these names: 2,5-Bis(trifluoromethyl)benzyl alcohol, 95%, (2,5-Bis(trifluoromethyl)phenyl)methanol, 95%, (2,5–Bis(trifluoromethyl)phenyl)methanol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g.
[2,5-bis(trifluoromethyl)phenyl]methanol (CAS 302911-97-3) is a chemical compound with the molecular formula C9H6F6O and a molecular weight of 244.13 g/mol. IUPAC name: [2,5-bis(trifluoromethyl)phenyl]methanol. InChIKey: IFJMDKFBPFFXPC-UHFFFAOYSA-N.
| Molecular formula | C9H6F6O |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | [2,5-bis(trifluoromethyl)phenyl]methanol |
| InChIKey | IFJMDKFBPFFXPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CO)C(F)(F)F |
Computed by PubChem (NCBI)