Products 14316-68-8
CAS 14316-68-8 appears in our catalog under these names: Tiglic anhydride, 95%, Tiglicanhydride, 98%, Tiglic Anhydride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 10g, 5g, 1ml.
[(E)-2-methylbut-2-enoyl] (E)-2-methylbut-2-enoate (CAS 14316-68-8) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: [(E)-2-methylbut-2-enoyl] (E)-2-methylbut-2-enoate. InChIKey: LIHLSLRANKCHLV-KQQUZDAGSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | [(E)-2-methylbut-2-enoyl] (E)-2-methylbut-2-enoate |
| InChIKey | LIHLSLRANKCHLV-KQQUZDAGSA-N |
| SMILES | C/C=C(/C(=O)OC(=O)/C(=C/C)/C)\C |
Computed by PubChem (NCBI)