CAS 94487-74-8 appears in our catalog under these names: Angelic anhydride, 95%, Angelic anhydride, 97%, Angelic anhydride/ 96.69% (existing batch purity), Angelic Anhydride, >98.0%(T), (Z)-2-Methylbut-2-enoic anhydride, 99.70% ,, 99.70% ,. Offered by: Combi-blocks, AmBeed, TargetMol, TCI, Chemat. Available pack sizes: 5g, 1g, 20mg, 250mg, 100 mg, 250 mg, 500 mg.
[(Z)-2-methylbut-2-enoyl] (Z)-2-methylbut-2-enoate (CAS 94487-74-8) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: [(Z)-2-methylbut-2-enoyl] (Z)-2-methylbut-2-enoate. InChIKey: LIHLSLRANKCHLV-SFECMWDFSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | [(Z)-2-methylbut-2-enoyl] (Z)-2-methylbut-2-enoate |
| InChIKey | LIHLSLRANKCHLV-SFECMWDFSA-N |
| SMILES | C/C=C(\C(=O)OC(=O)/C(=C\C)/C)/C |
Computed by PubChem (NCBI)