CAS 1431734-83-6 is the registry number for Ethyl 4-chloro-1,6-dimethyl-2-oxo-1,2-dihydroquinoline-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-chloro-1,6-dimethyl-2-oxoquinoline-3-carboxylate (CAS 1431734-83-6) is a chemical compound with the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. IUPAC name: ethyl 4-chloro-1,6-dimethyl-2-oxoquinoline-3-carboxylate. InChIKey: KPPAQLZQSQKVAK-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO3 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | ethyl 4-chloro-1,6-dimethyl-2-oxoquinoline-3-carboxylate |
| InChIKey | KPPAQLZQSQKVAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC(=C2)C)N(C1=O)C)Cl |
Computed by PubChem (NCBI)