Products 384821-06-1

CAS 384821-06-1 appears in our catalog under these names: ethyl 4–chloro–6–methoxy–8–methylquinoline–3–carboxylate, Ethyl 4-chloro-6-methoxy-8-methyl-3-quinolinecarboxylate. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-chloro-6-methoxy-8-methylquinoline-3-carboxylate (CAS 384821-06-1) is a chemical compound with the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. IUPAC name: ethyl 4-chloro-6-methoxy-8-methylquinoline-3-carboxylate. InChIKey: UVYAEJZOEOXLQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14ClNO3
Molecular weight279.72 g/mol
IUPAC nameethyl 4-chloro-6-methoxy-8-methylquinoline-3-carboxylate
InChIKeyUVYAEJZOEOXLQQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C2C(=CC(=CC2=C1Cl)OC)C

Computed by PubChem (NCBI)