Products 2640733-05-5
CAS 2640733-05-5 is the registry number for Ethyl 2-(7-chloro-1-oxoisoquinolin-2(1H)-yl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(7-chloro-1-oxoisoquinolin-2-yl)propanoate (CAS 2640733-05-5) is a chemical compound with the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. IUPAC name: ethyl 2-(7-chloro-1-oxoisoquinolin-2-yl)propanoate. InChIKey: IQAQPXVYNTZUFP-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO3 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | ethyl 2-(7-chloro-1-oxoisoquinolin-2-yl)propanoate |
| InChIKey | IQAQPXVYNTZUFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)N1C=CC2=C(C1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)