CAS 2222114-60-3 appears in our catalog under these names: Rel-(1r,4r)-4-(3-chloro-4-cyanophenoxy)cyclohexane-1-carboxylic acid, 98%, Rel-(1r,4r)-4-(3-chloro-4-cyanophenoxy)cyclohexane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g.
4-(3-chloro-4-cyanophenoxy)cyclohexane-1-carboxylic acid (CAS 2222114-60-3) is a chemical compound with the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. IUPAC name: 4-(3-chloro-4-cyanophenoxy)cyclohexane-1-carboxylic acid. InChIKey: URWXZLPRVMBAIC-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO3 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 4-(3-chloro-4-cyanophenoxy)cyclohexane-1-carboxylic acid |
| InChIKey | URWXZLPRVMBAIC-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)OC2=CC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)