CAS 1431963-41-5 appears in our catalog under these names: 4-(Indol-1-yl)aniline hydrochloride, 98%, 4-(Indol-1-yl)aniline hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 100g, 1g, 25g, 5g, 2,5g.
4-indol-1-ylaniline;hydrochloride (CAS 1431963-41-5) is a chemical compound with the molecular formula C14H13ClN2 and a molecular weight of 244.72 g/mol. IUPAC name: 4-indol-1-ylaniline;hydrochloride. InChIKey: LVGDFUPLIFKNGK-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | 4-indol-1-ylaniline;hydrochloride |
| InChIKey | LVGDFUPLIFKNGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=CC=C(C=C3)N.Cl |
Computed by PubChem (NCBI)