CAS 546114-49-2 is the registry number for N-Benzyl-4-chlorobenzenecarboximidamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
N'-benzyl-4-chlorobenzenecarboximidamide (CAS 546114-49-2) is a chemical compound with the molecular formula C14H13ClN2 and a molecular weight of 244.72 g/mol. IUPAC name: N'-benzyl-4-chlorobenzenecarboximidamide. InChIKey: UXJDEKUGJUQMDW-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | N'-benzyl-4-chlorobenzenecarboximidamide |
| InChIKey | UXJDEKUGJUQMDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN=C(C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)