CAS 5606-40-6 appears in our catalog under these names: Diazepam Impurity 11, Diazepam Impurity 4, Diazepam Impurity 10, 4-Chloro-2-(iminophenylmethyl)-N-methylbenzenamine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(benzenecarboximidoyl)-4-chloro-N-methylaniline (CAS 5606-40-6) is a chemical compound with the molecular formula C14H13ClN2 and a molecular weight of 244.72 g/mol. IUPAC name: 2-(benzenecarboximidoyl)-4-chloro-N-methylaniline. InChIKey: YIBUYDHSWMGPBG-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | 2-(benzenecarboximidoyl)-4-chloro-N-methylaniline |
| InChIKey | YIBUYDHSWMGPBG-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)Cl)C(=N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)