CAS 7296-20-0 is the registry number for 2,9-Dimethyl-1,10-phenanthroline hydrochloride. Offered by: Chemat. Available pack sizes: 100g, 25g.
2,9-dimethyl-1,10-phenanthroline;hydrochloride (CAS 7296-20-0) is a chemical compound with the molecular formula C14H13ClN2 and a molecular weight of 244.72 g/mol. IUPAC name: 2,9-dimethyl-1,10-phenanthroline;hydrochloride. InChIKey: QUGBNSJLQDNNPK-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | 2,9-dimethyl-1,10-phenanthroline;hydrochloride |
| InChIKey | QUGBNSJLQDNNPK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C.Cl |
Computed by PubChem (NCBI)