Products 1431965-00-2

CAS 1431965-00-2 is the registry number for Ethyl 4-amino-1-methyl-1H-pyrazole-5-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 4-amino-1-methylpyrazole-5-carboxylate;hydrochloride (CAS 1431965-00-2) is a chemical compound with the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. IUPAC name: ethyl 4-amino-1-methylpyrazole-5-carboxylate;hydrochloride. InChIKey: BCSLZWZVBUUYOI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClN3O2
Molecular weight205.64 g/mol
IUPAC nameethyl 4-amino-1-methylpyrazole-5-carboxylate;hydrochloride
InChIKeyBCSLZWZVBUUYOI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=NN1C)N.Cl

Computed by PubChem (NCBI)