CAS 1431966-14-1 is the registry number for 1-(3,3,3-Trifluoropropyl)-1H-pyrazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,3,3-trifluoropropyl)pyrazol-4-amine;hydrochloride (CAS 1431966-14-1) is a chemical compound with the molecular formula C6H9ClF3N3 and a molecular weight of 215.60 g/mol. IUPAC name: 1-(3,3,3-trifluoropropyl)pyrazol-4-amine;hydrochloride. InChIKey: LTUNBXDMXCWAKD-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N3 |
|---|---|
| Molecular weight | 215.60 g/mol |
| IUPAC name | 1-(3,3,3-trifluoropropyl)pyrazol-4-amine;hydrochloride |
| InChIKey | LTUNBXDMXCWAKD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)