Products 2044796-63-4
CAS 2044796-63-4 appears in our catalog under these names: 3,3,3-Trifluoro-2-(1H-pyrazol-1-yl)propan-1-amine hydrochloride, 95%, 3,3,3-Trifluoro-2-(1H-pyrazol-1-yl)propan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3,3,3-trifluoro-2-pyrazol-1-ylpropan-1-amine;hydrochloride (CAS 2044796-63-4) is a chemical compound with the molecular formula C6H9ClF3N3 and a molecular weight of 215.60 g/mol. IUPAC name: 3,3,3-trifluoro-2-pyrazol-1-ylpropan-1-amine;hydrochloride. InChIKey: WVCGOKXZRILZKO-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N3 |
|---|---|
| Molecular weight | 215.60 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-pyrazol-1-ylpropan-1-amine;hydrochloride |
| InChIKey | WVCGOKXZRILZKO-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C(CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)