CAS 1432031-03-2 appears in our catalog under these names: [1-(2,2,2-Trifluoroethyl)-1h-pyrazol-3-yl]methanamine hydrochloride, 95%, 1-(1-(2,2,2-Trifluoroethyl)-1H-pyrazol-3-yl)methanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanamine;hydrochloride (CAS 1432031-03-2) is a chemical compound with the molecular formula C6H9ClF3N3 and a molecular weight of 215.60 g/mol. IUPAC name: [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanamine;hydrochloride. InChIKey: ZHXZAZRPDHFXIZ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N3 |
|---|---|
| Molecular weight | 215.60 g/mol |
| IUPAC name | [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanamine;hydrochloride |
| InChIKey | ZHXZAZRPDHFXIZ-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1CN)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)