Products 1986298-02-5
CAS 1986298-02-5 appears in our catalog under these names: [1-(2,2,2-Trifluoroethyl)-1h-pyrazol-4-yl]methanamine hydrochloride, 95%, (1-(2,2,2-Trifluoroethyl)-1H-pyrazol-4-yl)methanamine hydrochloride, 97+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methanamine;hydrochloride (CAS 1986298-02-5) is a chemical compound with the molecular formula C6H9ClF3N3 and a molecular weight of 215.60 g/mol. IUPAC name: [1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methanamine;hydrochloride. InChIKey: FKTJNBOHYALZLX-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N3 |
|---|---|
| Molecular weight | 215.60 g/mol |
| IUPAC name | [1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methanamine;hydrochloride |
| InChIKey | FKTJNBOHYALZLX-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CC(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)