Products 1431983-55-9
CAS 1431983-55-9 is the registry number for 4-[1-(trifluoromethyl)cyclopropyl]phenol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4-[1-(trifluoromethyl)cyclopropyl]phenol (CAS 1431983-55-9) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 4-[1-(trifluoromethyl)cyclopropyl]phenol. InChIKey: OVEQMKGFDCLWCQ-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 4-[1-(trifluoromethyl)cyclopropyl]phenol |
| InChIKey | OVEQMKGFDCLWCQ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)O)C(F)(F)F |
Computed by PubChem (NCBI)