Products 1432026-25-9
CAS 1432026-25-9 is the registry number for 1-((1,3-Dimethyl-1H-pyrazol-4-yl)methyl)-1H-pyrazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrazol-4-amine;hydrochloride (CAS 1432026-25-9) is a chemical compound with the molecular formula C9H14ClN5 and a molecular weight of 227.69 g/mol. IUPAC name: 1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrazol-4-amine;hydrochloride. InChIKey: KLQNCAGPVSYIRW-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN5 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 1-[(1,3-dimethylpyrazol-4-yl)methyl]pyrazol-4-amine;hydrochloride |
| InChIKey | KLQNCAGPVSYIRW-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1CN2C=C(C=N2)N)C.Cl |
Computed by PubChem (NCBI)