Products 1432062-53-7
CAS 1432062-53-7 is the registry number for 3-(3-Hydroxy-3-methylbutanyl)-2,4,6-trihydroxybenzophenone. Offered by: MedChemExpress. Available pack sizes: Get quote.
Phenyl-[2,4,6-trihydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]methanone (CAS 1432062-53-7) is a chemical compound with the molecular formula C18H20O5 and a molecular weight of 316.3 g/mol. IUPAC name: phenyl-[2,4,6-trihydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]methanone. InChIKey: WBIQLKREZMXFIJ-UHFFFAOYSA-N.
| Molecular formula | C18H20O5 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | phenyl-[2,4,6-trihydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]methanone |
| InChIKey | WBIQLKREZMXFIJ-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC1=C(C(=C(C=C1O)O)C(=O)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)