CAS 1432075-80-3 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethyl)styrene, 95%, 2,4-Difluoro-3-(trifluoromethyl)styrene, 97% mix TBC as stabilizer. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-ethenyl-2,4-difluoro-3-(trifluoromethyl)benzene (CAS 1432075-80-3) is a chemical compound with the molecular formula C9H5F5 and a molecular weight of 208.13 g/mol. IUPAC name: 1-ethenyl-2,4-difluoro-3-(trifluoromethyl)benzene. InChIKey: HCEKLZUWPVOJJQ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 1-ethenyl-2,4-difluoro-3-(trifluoromethyl)benzene |
| InChIKey | HCEKLZUWPVOJJQ-UHFFFAOYSA-N |
| SMILES | C=CC1=C(C(=C(C=C1)F)C(F)(F)F)F |
Computed by PubChem (NCBI)