CAS 1736-60-3 appears in our catalog under these names: 3-(Pentafluorophenyl)-1-propene 96%, Allylpentafluorobenzene, 95%, Allylpentafluorobenzene, Allylpentafluorobenzene, >98.0%(GC), Allylpentafluorobenzene, 97%. Offered by: Ambeed, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g.
1,2,3,4,5-pentafluoro-6-prop-2-enylbenzene (CAS 1736-60-3) is a chemical compound with the molecular formula C9H5F5 and a molecular weight of 208.13 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-prop-2-enylbenzene. InChIKey: YBDBTBVNQQBHGJ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-prop-2-enylbenzene |
| InChIKey | YBDBTBVNQQBHGJ-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)