CAS 15948-70-6 is the registry number for 1,2,3,4,5-Pentafluoro-6-[(1e)-prop-1-en-1-yl]benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2,3,4,5-pentafluoro-6-[(E)-prop-1-enyl]benzene (CAS 15948-70-6) is a chemical compound with the molecular formula C9H5F5 and a molecular weight of 208.13 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-[(E)-prop-1-enyl]benzene. InChIKey: ARAOLTCZMIFYMK-NSCUHMNNSA-N.
| Molecular formula | C9H5F5 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-[(E)-prop-1-enyl]benzene |
| InChIKey | ARAOLTCZMIFYMK-NSCUHMNNSA-N |
| SMILES | C/C=C/C1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)