CAS 2756153-92-9 is the registry number for 1,5-Difluoro-2-(trifluoromethyl)-3-vinylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethenyl-3,5-difluoro-2-(trifluoromethyl)benzene (CAS 2756153-92-9) is a chemical compound with the molecular formula C9H5F5 and a molecular weight of 208.13 g/mol. IUPAC name: 1-ethenyl-3,5-difluoro-2-(trifluoromethyl)benzene. InChIKey: XGWDEDXBSDBPFQ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 1-ethenyl-3,5-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | XGWDEDXBSDBPFQ-UHFFFAOYSA-N |
| SMILES | C=CC1=C(C(=CC(=C1)F)F)C(F)(F)F |
Computed by PubChem (NCBI)