CAS 143218-10-4 appears in our catalog under these names: Z–2–Nal–OH, Z-D-2-Nal-OH 98%, Z-D-2-Nal-OH, 98%, 98%, Z-D-2-Nal-OH, 99.78%, Z-3-(2-Naphthyl)-D-alanine, 95+%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 10 g, 1 g, 5 g, 25 g.
(2R)-3-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 143218-10-4) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (2R)-3-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: XBRPIBMAJOTVHG-LJQANCHMSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2R)-3-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | XBRPIBMAJOTVHG-LJQANCHMSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC2=CC3=CC=CC=C3C=C2)C(=O)O |
Computed by PubChem (NCBI)