Products 143238-38-4
CAS 143238-38-4 appears in our catalog under these names: tert-Butyl piperazine-1-carboxylate acetate, 98%, 1-Boc-piperazine acetate 98%, 1-Boc-piperazine acetate, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100g, 1000g, 25g, 500g, 1kg.
Acetic acid;tert-butyl piperazine-1-carboxylate (CAS 143238-38-4) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: acetic acid;tert-butyl piperazine-1-carboxylate. InChIKey: VRYAIUMHCRSUDX-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | acetic acid;tert-butyl piperazine-1-carboxylate |
| InChIKey | VRYAIUMHCRSUDX-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(C)(C)OC(=O)N1CCNCC1 |
Computed by PubChem (NCBI)
Synonyms:
1-Boc-piperazine acetate, tert-Butyl piperazine-1-carboxylate acetate, acetic acid;tert-butyl piperazine-1-carboxylate, 1-Boc-piperazineacetate, 1-Piperazinecarboxylic acid, 1,1-dimethylethyl ester, monoacetate, 1-Boc-piperazine acetic acid, Olaparib Impurity 25 Acetate, t-Butyl piperazine-1-carboxylate acetate, N-Boc-piperazine acetic acid;tert-Butyl piperazine-1-carboxylate