Products 1432679-12-3
CAS 1432679-12-3 appears in our catalog under these names: 2-(3-Chloropropyl)-5-methoxy-1H-imidazo(4,5-b)pyridine hydrochloride, 95%, 2-(3-Chloropropyl)-5-methoxy-1H-imidazo(4,5-b)pyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3-chloropropyl)-5-methoxy-1H-imidazo[4,5-b]pyridine;hydrochloride (CAS 1432679-12-3) is a chemical compound with the molecular formula C10H13Cl2N3O and a molecular weight of 262.13 g/mol. IUPAC name: 2-(3-chloropropyl)-5-methoxy-1H-imidazo[4,5-b]pyridine;hydrochloride. InChIKey: OXVLJDPMJGRCTA-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 2-(3-chloropropyl)-5-methoxy-1H-imidazo[4,5-b]pyridine;hydrochloride |
| InChIKey | OXVLJDPMJGRCTA-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)NC(=N2)CCCCl.Cl |
Computed by PubChem (NCBI)