CAS 1594573-44-0 is the registry number for rel-(2R,6S)-4-(3,6-Dichloropyridazin-4-yl)-2,6-dimethylmorpholine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,6S)-4-(3,6-dichloropyridazin-4-yl)-2,6-dimethylmorpholine (CAS 1594573-44-0) is a chemical compound with the molecular formula C10H13Cl2N3O and a molecular weight of 262.13 g/mol. IUPAC name: (2R,6S)-4-(3,6-dichloropyridazin-4-yl)-2,6-dimethylmorpholine. InChIKey: UQIGBFCBEDRYQM-KNVOCYPGSA-N.
| Molecular formula | C10H13Cl2N3O |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | (2R,6S)-4-(3,6-dichloropyridazin-4-yl)-2,6-dimethylmorpholine |
| InChIKey | UQIGBFCBEDRYQM-KNVOCYPGSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)